EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N4O3 |
| Net Charge | +1 |
| Average Mass | 191.211 |
| Monoisotopic Mass | 191.11387 |
| SMILES | [NH2+]=C(NO)NCCC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H14N4O3/c7-4(5(11)12)2-1-3-9-6(8)10-13/h4,13H,1-3,7H2,(H,11,12)(H3,8,9,10)/p+1/t4-/m0/s1 |
| InChIKey | FQWRAVYMZULPNK-BYPYZUCNSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N5-[(hydroxyamino)(imino)methyl]-L-ornithinium(1+) (CHEBI:60107) is a α-amino-acid cation (CHEBI:33719) |
| N5-[(hydroxyamino)(imino)methyl]-L-ornithinium(1+) (CHEBI:60107) is conjugate acid of N5-[(hydroxyamino)(imino)methyl]-L-ornithine (CHEBI:43088) |
| Incoming Relation(s) |
| N5-[(hydroxyamino)(imino)methyl]-L-ornithine (CHEBI:43088) is conjugate base of N5-[(hydroxyamino)(imino)methyl]-L-ornithinium(1+) (CHEBI:60107) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-{[(hydroxyamino)(iminio)methyl]amino}pentanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-ammonio-5-{[(hydroxyamino)(iminio)methyl]amino}pentanoate | ChEBI |
| N5-[(hydroxyamino)(imino)methyl]-L-ornithinium cation | ChEBI |
| L-hydroxyarginine | MetaCyc |
| UniProt Name | Source |
|---|---|
| Nω-hydroxy-L-arginine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-13518 | MetaCyc |