EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16MoN6O10PS3 |
| Net Charge | -2 |
| Average Mass | 639.418 |
| Monoisotopic Mass | 640.88927 |
| SMILES | [H][C@@]12Nc3c(nc(N)nc3=O)N[C@]1([H])O[C@H](COP(=O)([O-])[O-])C1=C2[S][Mo](=[O])(=[O])([S]C[C@H](N)C(=O)O)[S]1 |
| InChI | InChI=1S/C10H14N5O6PS2.C3H7NO2S.Mo.2O/c11-10-14-7-4(8(16)15-10)12-3-6(24)5(23)2(21-9(3)13-7)1-20-22(17,18)19;4-2(1-7)3(5)6;;;/h2-3,9,12,23-24H,1H2,(H2,17,18,19)(H4,11,13,14,15,16);2,7H,1,4H2,(H,5,6);;;/q;;+3;;/p-5/t2-,3+,9-;2-;;;/m10.../s1 |
| InChIKey | YXUIUEIXESWPFX-UPKSQWNVSA-I |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-cysteinyl sulfurated eukaryotic molybdenum cofactor(2−) (CHEBI:60103) has functional parent Mo(VI)(=O)(=S)(OH)-molybdopterin cofactor(3−) (CHEBI:60102) |
| L-cysteinyl sulfurated eukaryotic molybdenum cofactor(2−) (CHEBI:60103) is a Mo-molybdopterin cofactor (CHEBI:21437) |
| L-cysteinyl sulfurated eukaryotic molybdenum cofactor(2−) (CHEBI:60103) is a molybdopterin cofactor (CHEBI:25372) |
| IUPAC Name |
|---|
| {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-3,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(4−) phosphate}(L-cysteinato-κS3)dioxomolibdate(2−) |
| Synonyms | Source |
|---|---|
| cysteine ligated molybdenum cofactor | SUBMITTER |
| L-cysteinyl-MoCo | ChEBI |
| Citations |
|---|