EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H7NO |
| Net Charge | 0 |
| Average Mass | 133.150 |
| Monoisotopic Mass | 133.05276 |
| SMILES | Cc1ccccc1N=C=O |
| InChI | InChI=1S/C8H7NO/c1-7-4-2-3-5-8(7)9-6-10/h2-5H,1H3 |
| InChIKey | VAYMIYBJLRRIFR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-tolyl isocyanate (CHEBI:60099) has role hapten (CHEBI:59174) |
| 2-tolyl isocyanate (CHEBI:60099) is a isocyanates (CHEBI:53212) |
| 2-tolyl isocyanate (CHEBI:60099) is a toluenes (CHEBI:27024) |
| IUPAC Name |
|---|
| 1-isocyanato-2-methylbenzene |
| Synonyms | Source |
|---|---|
| 2-toluene isocyanate | ChEBI |
| 2-Methylphenyl isocyanate | ChemIDplus |
| 2-methylphenylisocyanate | ChEBI |
| o-Tolyl isocyanate | ChemIDplus |
| o-Methylphenyl isocyanate | ChemIDplus |
| o-Toluene isocyanate | ChemIDplus |
| Citations |
|---|