EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H9NO |
| Net Charge | 0 |
| Average Mass | 147.177 |
| Monoisotopic Mass | 147.06841 |
| SMILES | Cc1ccc(N=C=O)cc1C |
| InChI | InChI=1S/C9H9NO/c1-7-3-4-9(10-6-11)5-8(7)2/h3-5H,1-2H3 |
| InChIKey | AYCDBMRVKSXYKW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethylphenyl isocyanate (CHEBI:60098) has role hapten (CHEBI:59174) |
| 3,4-dimethylphenyl isocyanate (CHEBI:60098) is a isocyanates (CHEBI:53212) |
| IUPAC Name |
|---|
| 4-isocyanato-1,2-dimethylbenzene |
| Synonyms | Source |
|---|---|
| 3,4-dimethyl phenylisocyanate | ChEBI |
| 3,4-dimethylphenylisocyanate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Gmelin:561659 | Gmelin |
| Reaxys:775149 | Reaxys |
| Citations |
|---|