EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H46N13O10 |
| Net Charge | +3 |
| Average Mass | 688.724 |
| Monoisotopic Mass | 688.34741 |
| SMILES | [H][C@]1([C@]2([H])NC(=O)/C(=C/NC(N)=O)NC(=O)[C@H](CO)NC(=O)[C@H](CO)NC(=O)[C@@H](NC(=O)C[C@@H]([NH3+])CCC[NH3+])CNC2=O)C[C@H](O)NC(=[NH2+])N1 |
| InChI | InChI=1S/C25H43N13O10/c26-3-1-2-10(27)4-16(41)32-12-6-30-23(47)18(11-5-17(42)37-24(28)36-11)38-20(44)13(7-31-25(29)48)33-21(45)14(8-39)35-22(46)15(9-40)34-19(12)43/h7,10-12,14-15,17-18,39-40,42H,1-6,8-9,26-27H2,(H,30,47)(H,32,41)(H,33,45)(H,34,43)(H,35,46)(H,38,44)(H3,28,36,37)(H3,29,31,48)/p+3/b13-7-/t10-,11+,12-,14-,15-,17-,18-/m0/s1 |
| InChIKey | GXFAIFRPOKBQRV-GHXCTMGLSA-Q |
| Roles Classification |
|---|
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| viomycin(3+) (CHEBI:60081) has role antitubercular agent (CHEBI:33231) |
| viomycin(3+) (CHEBI:60081) is a cyclic peptide cation (CHEBI:60195) |
| viomycin(3+) (CHEBI:60081) is conjugate acid of viomycin (CHEBI:15782) |
| Incoming Relation(s) |
| O-phosphoviomycin(1+) (CHEBI:60080) has functional parent viomycin(3+) (CHEBI:60081) |
| viomycin (CHEBI:15782) is conjugate base of viomycin(3+) (CHEBI:60081) |
| UniProt Name | Source |
|---|---|
| viomycin | UniProt |