EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6N2O4 |
| Net Charge | 0 |
| Average Mass | 194.146 |
| Monoisotopic Mass | 194.03276 |
| SMILES | COc1cc([N+](=O)[O-])ccc1N=C=O |
| InChI | InChI=1S/C8H6N2O4/c1-14-8-4-6(10(12)13)2-3-7(8)9-5-11/h2-4H,1H3 |
| InChIKey | VOTZJLLPYYCZRY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-methoxy-4-nitrophenyl isocyanate (CHEBI:60066) has role hapten (CHEBI:59174) |
| 2-methoxy-4-nitrophenyl isocyanate (CHEBI:60066) is a 3-nitroanisoles (CHEBI:48974) |
| 2-methoxy-4-nitrophenyl isocyanate (CHEBI:60066) is a isocyanates (CHEBI:53212) |
| IUPAC Name |
|---|
| 1-isocyanato-2-methoxy-4-nitrobenzene |
| Synonym | Source |
|---|---|
| 2-isocyanato-5-nitrophenyl methyl ether | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:2848613 | Beilstein |
| Citations |
|---|