EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C14H20NO11)n.H2O |
| Net Charge | -1 |
| Average Mass | 396.325 |
| Monoisotopic Mass | 396.11475 |
| SMILES | [H]O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O[C@@H]2O[C@@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H23NO12/c1-3(17)15-5-10(6(18)4(2-16)25-13(5)24)26-14-9(21)7(19)8(20)11(27-14)12(22)23/h4-11,13-14,16,18-21,24H,2H2,1H3,(H,15,17)(H,22,23)/p-1/t4-,5-,6+,7+,8+,9-,10-,11-,13-,14-/m1/s1 |
| InChIKey | LJORHONFMDUUHP-ILWVTJRESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dermatan anion (CHEBI:60059) is a carbohydrate acid derivative anion (CHEBI:63551) |
| dermatan anion (CHEBI:60059) is conjugate base of dermatan (CHEBI:4439) |
| Incoming Relation(s) |
| dermatan (CHEBI:4439) is conjugate acid of dermatan anion (CHEBI:60059) |
| Synonym | Source |
|---|---|
| dermatan polyanion | ChEBI |
| UniProt Name | Source |
|---|---|
| dermatan | UniProt |