EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H21NO3 |
| Net Charge | 0 |
| Average Mass | 239.315 |
| Monoisotopic Mass | 239.15214 |
| SMILES | CCC(NC(C)C)C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H21NO3/c1-4-10(14-8(2)3)13(17)9-5-6-11(15)12(16)7-9/h5-8,10,13-17H,4H2,1-3H3 |
| InChIKey | HUYWAWARQUIQLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoetharine (CHEBI:6005) is a catecholamine (CHEBI:33567) |
| Synonyms | Source |
|---|---|
| etyprenaline | DrugCentral |
| isoctarine | DrugCentral |
| isoetarin | DrugCentral |
| isoetharine | DrugCentral |
| Isoetharine | KEGG COMPOUND |
| isoetharine HCl | DrugCentral |
| Manual Xrefs | Databases |
|---|---|
| 1491 | DrugCentral |
| C07053 | KEGG COMPOUND |
| D04625 | KEGG DRUG |
| HMDB0014366 | HMDB |
| LSM-4374 | LINCS |
| Registry Numbers | Sources |
|---|---|
| CAS:530-08-5 | KEGG COMPOUND |