EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO2 |
| Net Charge | 0 |
| Average Mass | 115.132 |
| Monoisotopic Mass | 115.06333 |
| SMILES | O=C([O-])[C@@H]1CCC[NH2+]1 |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m0/s1 |
| InChIKey | ONIBWKKTOPOVIA-BYPYZUCNSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-proline zwitterion (CHEBI:60039) is a amino-acid zwitterion (CHEBI:35238) |
| L-proline zwitterion (CHEBI:60039) is tautomer of L-proline (CHEBI:17203) |
| Incoming Relation(s) |
| L-proline (CHEBI:17203) is tautomer of L-proline zwitterion (CHEBI:60039) |
| IUPAC Name |
|---|
| (2S)-pyrrolidinium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| L-proline | UniProt |
| Manual Xrefs | Databases |
|---|---|
| PRO | MetaCyc |