EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H13O7 |
| Net Charge | -1 |
| Average Mass | 329.284 |
| Monoisotopic Mass | 329.06668 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc([O-])cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3/p-1 |
| InChIKey | HRGUSFBJBOKSML-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-di-O-methyltricetin(1−) (CHEBI:60016) is a flavonoid oxoanion (CHEBI:60038) |
| 3',5'-di-O-methyltricetin(1−) (CHEBI:60016) is conjugate base of 3',5'-di-O-methyltricetin (CHEBI:59979) |
| Incoming Relation(s) |
| 3',5'-di-O-methyltricetin (CHEBI:59979) is conjugate acid of 3',5'-di-O-methyltricetin(1−) (CHEBI:60016) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-chromen-7-olate |
| UniProt Name | Source |
|---|---|
| 3',5'-di-O-methyltricetin | UniProt |