EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C72H101N17O26 |
| Net Charge | 0 |
| Average Mass | 1620.693 |
| Monoisotopic Mass | 1619.71037 |
| SMILES | CCCCCCCCCC(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CC(N)=O)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H]1C(=O)NCC(=O)N[C@@H](CCCN)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)NCC(=O)N[C@H](CO)C(=O)N[C@@H]([C@H](C)CC(=O)O)C(=O)N[C@@H](CC(=O)c2ccccc2N)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C72H101N17O26/c1-5-6-7-8-9-10-11-22-53(93)81-44(25-38-31-76-42-20-15-13-17-39(38)42)66(108)84-45(27-52(75)92)67(109)86-48(30-59(102)103)68(110)89-61-37(4)115-72(114)49(26-51(91)40-18-12-14-19-41(40)74)87-71(113)60(35(2)24-56(96)97)88-69(111)50(34-90)82-55(95)32-77-63(105)46(28-57(98)99)83-62(104)36(3)79-65(107)47(29-58(100)101)85-64(106)43(21-16-23-73)80-54(94)33-78-70(61)112/h12-15,17-20,31,35-37,43-50,60-61,76,90H,5-11,16,21-30,32-34,73-74H2,1-4H3,(H2,75,92)(H,77,105)(H,78,112)(H,79,107)(H,80,94)(H,81,93)(H,82,95)(H,83,104)(H,84,108)(H,85,106)(H,86,109)(H,87,113)(H,88,111)(H,89,110)(H,96,97)(H,98,99)(H,100,101)(H,102,103)/t35-,36-,37-,43+,44+,45+,46+,47+,48+,49+,50-,60+,61+/m1/s1 |
| InChIKey | DOAKLVKFURWEDJ-RWDRXURGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. calcium-dependent antibiotics Any antimicrobial agent whose activity is dependent on the presence of calcium ions. antibacterial drug A drug used to treat or prevent bacterial infections. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antibacterial drug A drug used to treat or prevent bacterial infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| daptomycin (CHEBI:600103) has role antibacterial drug (CHEBI:36047) |
| daptomycin (CHEBI:600103) has role bacterial metabolite (CHEBI:76969) |
| daptomycin (CHEBI:600103) has role calcium-dependent antibiotics (CHEBI:140190) |
| daptomycin (CHEBI:600103) is a heterodetic cyclic peptide (CHEBI:24533) |
| daptomycin (CHEBI:600103) is a lipopeptide (CHEBI:46895) |
| daptomycin (CHEBI:600103) is a lipopeptide antibiotic (CHEBI:25061) |
| daptomycin (CHEBI:600103) is a macrocycle (CHEBI:51026) |
| daptomycin (CHEBI:600103) is a macrolide (CHEBI:25106) |
| IUPAC Name |
|---|
| N-decanoyl-L-tryptophyl-L-asparaginyl-N-[(3S,6S,9R,15S,18R,21S,24S,30S,31R)-3-[2-(2-aminophenyl)-2-oxoethyl]-24-(3-aminopropyl)-15,21-bis(carboxymethyl)-6-[(2R)-1-carboxypropan-2-yl]-9-(hydroxymethyl)-18,31-dimethyl-2,5,8,11,14,17,20,23,26,29-decaoxo-1-oxa-4,7,10,13,16,19,22,25,28-nonaazacyclohentriacontan-30-yl]-L-α-asparagine |
| INNs | Source |
|---|---|
| daptomicina | ChemIDplus |
| daptomycin | ChemIDplus |
| daptomycine | ChemIDplus |
| daptomycinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| daptomycin | ChEMBL |
| Daptomycin | KEGG COMPOUND |
| N-decanoyl-L-tryptophyl-L-asparaginyl-L-aspartyl-L-threonylglycyl-L-ornithyl-L-aspartyl-D-alanyl-L-aspartylglycyl-D-seryl-threo-3-methyl-L-glutamyl-3-anthraniloyl-L-alanine 1.13-3.4-lactone | ChEBI |
| N-decanoyl-L-tryptophyl-L-asparaginyl-L-aspartyl-L-threonylglycyl-L-ornithyl-L-aspartyl-D-alanyl-L-aspartylglycyl-D-seryl-threo-3-methyl-L-glutamyl-3-anthraniloyl-L-alanine ε1-lactone | ChemIDplus |
| LY 146032 | ChemIDplus |
| Brand Names | Source |
|---|---|
| Cidecin | ChemIDplus |
| Cubicin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12013 | KEGG COMPOUND |
| D01080 | KEGG DRUG |
| Daptomycin | Wikipedia |
| DB00080 | DrugBank |
| Registry Numbers | Sources |
|---|---|
| CAS:103060-53-3 | ChemIDplus |
| CAS:103060-53-3 | KEGG COMPOUND |
| Citations |
|---|