EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20N6O9S |
| Net Charge | 0 |
| Average Mass | 520.480 |
| Monoisotopic Mass | 520.10125 |
| SMILES | [H][C@]12OCC(CSc3nnnn3C)=C(C(=O)O)N1C(=O)[C@]2(NC(=O)C(C(=O)O)c1ccc(O)cc1)OC |
| InChI | InChI=1S/C20H20N6O9S/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32)/t12?,18-,20+/m1/s1 |
| InChIKey | JWCSIUVGFCSJCK-CAVRMKNVSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| moxalactam (CHEBI:599928) has role antibacterial drug (CHEBI:36047) |
| moxalactam (CHEBI:599928) is a cephalosporin (CHEBI:23066) |
| moxalactam (CHEBI:599928) is a oxacephem (CHEBI:55506) |
| IUPAC Name |
|---|
| (6R,7R)-7-{[carboxy(4-hydroxyphenyl)acetyl]amino}-7-methoxy-3-{[(1-methyl-1H-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| INNs | Source |
|---|---|
| latamoxef | ChemIDplus |
| latamoxefum | ChemIDplus |
| Synonyms | Source |
|---|---|
| festamoxin | ChEBI |
| Lamoxactam | ChemIDplus |
| Latamoxef | KEGG COMPOUND |
| LMOX | KEGG DRUG |
| Moxalactam | KEGG COMPOUND |
| Oxa-cephem | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4222777 | Reaxys |
| CAS:64952-97-2 | ChemIDplus |
| Citations |
|---|