EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O4 |
| Net Charge | 0 |
| Average Mass | 254.286 |
| Monoisotopic Mass | 254.12666 |
| SMILES | N[C@@H](CCCCn1c(C=O)ccc1CO)C(=O)O |
| InChI | InChI=1S/C12H18N2O4/c13-11(12(17)18)3-1-2-6-14-9(7-15)4-5-10(14)8-16/h4-5,7,11,16H,1-3,6,8,13H2,(H,17,18)/t11-/m0/s1 |
| InChIKey | VTYFITADLSVOAS-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(L-norleucin-6-yl)pyrraline (CHEBI:59973) is a N-substituted pyrraline (CHEBI:131546) |
| 1-(L-norleucin-6-yl)pyrraline (CHEBI:59973) is a L-lysine derivative (CHEBI:25095) |
| 1-(L-norleucin-6-yl)pyrraline (CHEBI:59973) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 6-[2-formyl-5-(hydroxymethyl)-1H-pyrrol-1-yl]-L-norleucine |
| Synonyms | Source |
|---|---|
| ε-lysylpyrraline | ChEBI |
| 2-Amino-6-(2-formyl-5-hydroxymethylpyrrol-1-yl)hexanoic acid | ChemIDplus |
| 2-Formyl-5-(hydroxymethyl)pyrrole-1-norleucine | ChemIDplus |
| 2-Fhmpn | ChemIDplus |
| Pyrraline | ChemIDplus |
| (S)-α-amino-2-formyl-5-(hydroxymethyl)-1H-pyrrole-1-hexanoic acid | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7096285 | Reaxys |
| CAS:74509-14-1 | ChemIDplus |
| Citations |
|---|