EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29N4O4 |
| Net Charge | +1 |
| Average Mass | 341.432 |
| Monoisotopic Mass | 341.21833 |
| SMILES | Cc1cn(CCCC[C@H](N)C(=O)O)c[n+]1CCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C16H28N4O4/c1-12-10-19(8-4-2-6-13(17)15(21)22)11-20(12)9-5-3-7-14(18)16(23)24/h10-11,13-14H,2-9,17-18H2,1H3,(H-,21,22,23,24)/p+1/t13-,14-/m0/s1 |
| InChIKey | NVJLIMSDAPOFHF-KBPBESRZSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylglyoxal-lysine dimer (CHEBI:59963) has role epitope (CHEBI:53000) |
| methylglyoxal-lysine dimer (CHEBI:59963) is a L-lysine derivative (CHEBI:25095) |
| methylglyoxal-lysine dimer (CHEBI:59963) is a imidazolium ion (CHEBI:59964) |
| methylglyoxal-lysine dimer (CHEBI:59963) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Names |
|---|
| 1,3-bis[(5S)-5-amino-5-carboxypentyl]-4-methyl-1H-imidazol-3-ium |
| 1,3-bis[(5S)-5-amino-5-carboxypentyl]-5-methyl-1H-imidazol-3-ium |
| Synonyms | Source |
|---|---|
| imidazolysine | ChEBI |
| MOLD | ChEBI |
| Citations |
|---|