EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | [H][C@@]1(C(=C)C)CC[C@@]2(C)CCC=C(C)[C@]2([H])C1 |
| InChI | InChI=1S/C15H24/c1-11(2)13-7-9-15(4)8-5-6-12(3)14(15)10-13/h6,13-14H,1,5,7-10H2,2-4H3/t13-,14+,15-/m1/s1 |
| InChIKey | OZQAPQSEYFAMCY-QLFBSQMISA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-selinene (CHEBI:59961) has role plant metabolite (CHEBI:76924) |
| α-selinene (CHEBI:59961) is a octahydronaphthalenes (CHEBI:138397) |
| α-selinene (CHEBI:59961) is a selinene (CHEBI:49272) |
| IUPAC Name |
|---|
| (2R,4aR,8aR)-4a,8-dimethyl-2-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,8a-octahydronaphthalene |
| Synonyms | Source |
|---|---|
| (2R-(2α,4aα,8aβ))-1,2,3,4,4a,5,6,8a-octahydro-4a,8-dimethyl-2-(1-methylethenyl)naphthalene | ChemIDplus |
| 2-Isopropenyl-4a,8-dimethyl-1,2,3,4,4a,5,6,8a-octahydronaphthalene | NIST Chemistry WebBook |
| Eudesma-3,11-diene | ChEBI |
| UniProt Name | Source |
|---|---|
| α-selinene | UniProt |
| Manual Xrefs | Databases |
|---|---|
| Alpha-selinene | MetaCyc |
| HMDB0035810 | HMDB |
| Citations |
|---|