EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H26N6O4 |
| Net Charge | 0 |
| Average Mass | 378.433 |
| Monoisotopic Mass | 378.20155 |
| SMILES | N[C@@H](CCCCn1cccc2nc(NCCC[C@H](N)C(=O)O)nc1-2)C(=O)O |
| InChI | InChI=1S/C17H26N6O4/c18-11(15(24)25)5-1-2-9-23-10-4-7-13-14(23)22-17(21-13)20-8-3-6-12(19)16(26)27/h4,7,10-12H,1-3,5-6,8-9,18-19H2,(H,20,21)(H,24,25)(H,26,27)/t11-,12-/m0/s1 |
| InChIKey | AYEKKSTZQYEZPU-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Applications: | biomarker A substance used as an indicator of a biological state. cross-linking reagent A reagent with two reactive groups, usually at opposite ends of the molecule, that are capable of reacting with and thereby forming bridges between macromolecules, principally side chains of amino acids in proteins, allowing the locations of naturally reactive areas within the proteins to be identified. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentosidine (CHEBI:59951) has role biomarker (CHEBI:59163) |
| pentosidine (CHEBI:59951) has role cross-linking reagent (CHEBI:50684) |
| pentosidine (CHEBI:59951) is a imidazopyridine (CHEBI:46908) |
| pentosidine (CHEBI:59951) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 6-(2-{[(4S)-4-amino-4-carboxybutyl]amino}-4H-imidazo[4,5-b]pyridin-4-yl)-L-norleucine |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9298644 | Reaxys |
| CAS:124505-87-9 | ChemIDplus |
| Citations |
|---|