EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20NO3 |
| Net Charge | +1 |
| Average Mass | 298.362 |
| Monoisotopic Mass | 298.14377 |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC=C4[C@@H](C2)[NH+](C)CC[C@]431 |
| InChI | InChI=1S/C18H19NO3/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19/h3-4,6,12,17H,5,7-9H2,1-2H3/p+1/t12-,17+,18+/m1/s1 |
| InChIKey | LJVKMVSYTWPNGA-UUWFMWQGSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neopinone(1+) (CHEBI:59950) is a ammonium ion derivative (CHEBI:35274) |
| neopinone(1+) (CHEBI:59950) is conjugate acid of neopinone (CHEBI:7510) |
| Incoming Relation(s) |
| neopinone (CHEBI:7510) is conjugate base of neopinone(1+) (CHEBI:59950) |
| IUPAC Name |
|---|
| 3-methoxy-17-methyl-6-oxo-8,14-didehydro-4,5α-epoxymorphinan-17-ium |
| UniProt Name | Source |
|---|---|
| neopinone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-7712 | MetaCyc |
| Citations |
|---|