EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35NO |
| Net Charge | 0 |
| Average Mass | 317.517 |
| Monoisotopic Mass | 317.27186 |
| SMILES | CCC(C)(C)c1ccc(CC(C)CN2C[C@@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C21H35NO/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22/h8-11,16-18H,7,12-15H2,1-6H3/t16?,17-,18+ |
| InChIKey | MQHLMHIZUIDKOO-AYHJJNSGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). EC 1.3.1.70 (Delta(14)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ14-sterol reductase (EC 1.3.1.70). EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor An EC 5.3.3.* (intramolecular oxidase transposing C=C bonds) inhibitor that interferes with the action of a cholestenol Δ-isomerase (EC 5.3.3.5). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amorolfine (CHEBI:599440) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| amorolfine (CHEBI:599440) has role EC 1.3.1.70 (Δ14-sterol reductase) inhibitor (CHEBI:83319) |
| amorolfine (CHEBI:599440) has role EC 5.3.3.5 (cholestenol Δ-isomerase) inhibitor (CHEBI:86385) |
| amorolfine (CHEBI:599440) is a morpholine antifungal drug (CHEBI:87135) |
| amorolfine (CHEBI:599440) is a tertiary amino compound (CHEBI:50996) |
| amorolfine (CHEBI:599440) is conjugate base of amorolfine(1+) (CHEBI:86380) |
| Incoming Relation(s) |
| amorolfine(1+) (CHEBI:86380) is conjugate acid of amorolfine (CHEBI:599440) |
| IUPAC Name |
|---|
| (2R,6S)-2,6-dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine |
| INNs | Source |
|---|---|
| amorolfina | ChemIDplus |
| amorolfine | KEGG DRUG |
| amorolfinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (±)-cis-2,6-dimethyl-4-(2-methyl-3-(p-tert-pentylphenyl)propyl)morpholine | ChemIDplus |
| meso-2,6-dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine | ChEBI |
| meso-2,6-dimethyl-4-(2-methyl-3-(p-tert-pentylphenyl)propyl)morpholine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 188 | DrugCentral |
| Amorolfine | Wikipedia |
| D01720 | KEGG DRUG |
| D02923 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8154195 | Beilstein |
| CAS:78613-35-1 | ChemIDplus |
| CAS:78613-35-1 | KEGG DRUG |
| Citations |
|---|