EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H22O10 |
| Net Charge | 0 |
| Average Mass | 542.496 |
| Monoisotopic Mass | 542.12130 |
| SMILES | [H][C@]1([C@]2([H])C(=O)c3c(O)cc(O)cc3O[C@H]2c2ccc(O)cc2)C(=O)c2c(O)cc(O)cc2O[C@@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)29-25(27(37)23-19(35)9-17(33)11-21(23)39-29)26-28(38)24-20(36)10-18(34)12-22(24)40-30(26)14-3-7-16(32)8-4-14/h1-12,25-26,29-36H/t25-,26+,29+,30- |
| InChIKey | RNQBLQALVMHBKH-SQYWJIFTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stellera chamaejasme (ncbitaxon:142738) | root (BTO:0001188) | PubMed (16141313) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isochamaejasmin (CHEBI:5994) has role plant metabolite (CHEBI:76924) |
| isochamaejasmin (CHEBI:5994) is a biflavonoid (CHEBI:50128) |
| isochamaejasmin (CHEBI:5994) is a hydroxyflavone (CHEBI:24698) |
| IUPAC Name |
|---|
| (2R,2'S,3S,3'R)-5,5',7,7'-tetrahydroxy-2,2'-bis(4-hydroxyphenyl)-2,2',3,3'-tetrahydro-4H,4'H-[3,3'-bi-1-benzopyran]-4,4'-dione |
| Synonym | Source |
|---|---|
| 3,3''-Binaringenin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C09758 | KEGG COMPOUND |
| C00000972 | KNApSAcK |
| LMPK12040001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5198900 | Reaxys |
| CAS:93859-63-3 | KEGG COMPOUND |
| Citations |
|---|