EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H30N4 |
| Net Charge | +4 |
| Average Mass | 206.378 |
| Monoisotopic Mass | 206.24485 |
| SMILES | [NH3+]CCCC[NH2+]CCC[NH2+]CCC[NH3+] |
| InChI | InChI=1S/C10H26N4/c11-5-1-2-7-13-9-4-10-14-8-3-6-12/h13-14H,1-12H2/p+4 |
| InChIKey | DODDBCGMRAFLEB-UHFFFAOYSA-R |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thermosperminium(4+) (CHEBI:59903) is a ammonium ion derivative (CHEBI:35274) |
| thermosperminium(4+) (CHEBI:59903) is conjugate acid of thermospermine (CHEBI:59564) |
| Incoming Relation(s) |
| thermospermine (CHEBI:59564) is conjugate base of thermosperminium(4+) (CHEBI:59903) |
| IUPAC Name |
|---|
| N-{3-[(3-azaniumylpropyl)azaniumyl]propyl}butane-1,4-dizanium |
| Synonyms | Source |
|---|---|
| (4-azaniumylbutyl)({3-[(3- azaniumylpropyl)azaniumyl]propyl})azanium | ChEBI |
| thermosperminium tetracation | ChEBI |
| UniProt Name | Source |
|---|---|
| thermospermine | UniProt |