EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5NO3 |
| Net Charge | 0 |
| Average Mass | 103.077 |
| Monoisotopic Mass | 103.02694 |
| SMILES | N/C=C\C(=O)OO |
| InChI | InChI=1S/C3H5NO3/c4-2-1-3(5)7-6/h1-2,6H,4H2/b2-1- |
| InChIKey | WQKGFGLGYOHJOG-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (Z)-3-aminoperacrylic acid (CHEBI:59892) has functional parent acrylic acid (CHEBI:18308) |
| (Z)-3-aminoperacrylic acid (CHEBI:59892) is a enamine (CHEBI:47989) |
| (Z)-3-aminoperacrylic acid (CHEBI:59892) is a peroxy acid (CHEBI:52094) |
| IUPAC Name |
|---|
| (2Z)-3-aminoprop-2-eneperoxoic acid |
| Synonym | Source |
|---|---|
| peroxyaminoacrylate | ChEBI |
| UniProt Name | Source |
|---|---|
| (Z)-3-aminoperacrylic acid | UniProt |