EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32O15 |
| Net Charge | 0 |
| Average Mass | 596.538 |
| Monoisotopic Mass | 596.17412 |
| SMILES | O=C(/C=C/c1ccc(O)c(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)c1)c1ccc(O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1O |
| InChI | InChI=1S/C27H32O15/c28-9-18-20(33)22(35)24(37)26(41-18)39-12-3-4-13(16(32)8-12)14(30)5-1-11-2-6-15(31)17(7-11)40-27-25(38)23(36)21(34)19(10-29)42-27/h1-8,18-29,31-38H,9-10H2/b5-1+/t18-,19-,20-,21-,22+,23+,24-,25-,26-,27-/m1/s1 |
| InChIKey | XOTWNDIAAITUKR-KUUXHJTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Butea monosperma (ncbitaxon:56060) | flower (BTO:0000469) | PubMed (3725938) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isobutrin (CHEBI:5989) has functional parent trans-chalcone (CHEBI:48965) |
| isobutrin (CHEBI:5989) has role anti-inflammatory agent (CHEBI:67079) |
| isobutrin (CHEBI:5989) has role hepatoprotective agent (CHEBI:62868) |
| isobutrin (CHEBI:5989) has role plant metabolite (CHEBI:76924) |
| isobutrin (CHEBI:5989) is a chalcones (CHEBI:23086) |
| isobutrin (CHEBI:5989) is a monosaccharide derivative (CHEBI:63367) |
| isobutrin (CHEBI:5989) is a phenols (CHEBI:33853) |
| isobutrin (CHEBI:5989) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-{(1E)-3-[4-(β-D-glucopyranosyloxy)-2-hydroxyphenyl]-3-oxoprop-1-en-1-yl}-2-hydroxyphenyl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3,4'-bis-β-D-glucopyranosyloxy-4,2'-dihydroxy-transchalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00002382 | KNApSAcK |
| C08649 | KEGG COMPOUND |
| LMPK12120020 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:101892 | Reaxys |
| CAS:536-01-6 | ChemIDplus |
| CAS:536-01-6 | KEGG COMPOUND |
| Citations |
|---|