EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H6N2O4 |
| Net Charge | 0 |
| Average Mass | 146.102 |
| Monoisotopic Mass | 146.03276 |
| SMILES | NC(=O)N/C=C\C(=O)OO |
| InChI | InChI=1S/C4H6N2O4/c5-4(8)6-2-1-3(7)10-9/h1-2,9H,(H3,5,6,8)/b2-1- |
| InChIKey | AJFKXWQDHFYKFK-UPHRSURJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ureidoperacrylic acid (CHEBI:59889) has functional parent acrylic acid (CHEBI:18308) |
| ureidoperacrylic acid (CHEBI:59889) is a peroxy acid (CHEBI:52094) |
| ureidoperacrylic acid (CHEBI:59889) is a ureas (CHEBI:47857) |
| IUPAC Name |
|---|
| (2Z)-3-(carbamoylamino)prop-2-eneperoxoic acid |
| Synonym | Source |
|---|---|
| ureidoacrylate peracid | ChEBI |
| UniProt Name | Source |
|---|---|
| (Z)-3-ureidoacrylate peracid | UniProt |