EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO4 |
| Net Charge | 0 |
| Average Mass | 327.380 |
| Monoisotopic Mass | 327.14706 |
| SMILES | [H][C@]12Cc3cc(O)c(OC)cc3-c3c(O)c(OC)cc(c31)CCN2C |
| InChI | InChI=1S/C19H21NO4/c1-20-5-4-10-8-16(24-3)19(22)18-12-9-15(23-2)14(21)7-11(12)6-13(20)17(10)18/h7-9,13,21-22H,4-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | LINHZVMHXABQLB-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoboldine (CHEBI:5986) is a aporphine alkaloid (CHEBI:134209) |
| Synonyms | Source |
|---|---|
| Isoboldine | KEGG COMPOUND |
| 6aalpha-Aporphine-1,9-diol, 2,10-dimethoxy- | KEGG COMPOUND |
| (+)-Isoboldine | KEGG COMPOUND |
| Isoboldine | KEGG COMPOUND |
| 2,10-Dimethoxy-6aalpha-aporphine-1,9-diol | KEGG COMPOUND |