EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:59805 - (S)-dobutamine
| Formula | C18H23NO3 |
| Net Charge | 0 |
| Average Mass | 301.386 |
| Monoisotopic Mass | 301.16779 |
| SMILES | C[C@@H](CCc1ccc(O)cc1)NCCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C18H23NO3/c1-13(2-3-14-4-7-16(20)8-5-14)19-11-10-15-6-9-17(21)18(22)12-15/h4-9,12-13,19-22H,2-3,10-11H2,1H3/t13-/m0/s1 |
| InChIKey | JRWZLRBJNMZMFE-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. cardiotonic drug A drug that has a strengthening effect on the heart or that can increase cardiac output. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. beta-adrenergic agonist An agent that selectively binds to and activates β-adrenergic receptors. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-dobutamine (CHEBI:59805) is a dobutamine (CHEBI:4670) |
| (S)-dobutamine (CHEBI:59805) is a organic molecular entity (CHEBI:50860) |
| (S)-dobutamine (CHEBI:59805) is a phenols (CHEBI:33853) |
| (S)-dobutamine (CHEBI:59805) is enantiomer of (R)-dobutamine (CHEBI:59804) |
| Incoming Relation(s) |
| (R)-dobutamine (CHEBI:59804) is enantiomer of (S)-dobutamine (CHEBI:59805) |
| IUPAC Name |
|---|
| 4-(2-{[(2SS)-4-(4-hydroxyphenyl)butan-2-yl]amino}ethyl)benzene-1,2-diol |
| INNs | Source |
|---|---|
| levdobutamina | WHO MedNet |
| levdobutamine | WHO MedNet |
| Synonyms | Source |
|---|---|
| (S)-3,4-dihydroxy-N-[3-(4-hydroxyphenyl)-1-methylpropyl]-β-phenylethylamine | ChEBI |
| (S)-4-(2-((3-(p-hydroxyphenyl)-1-methylpropyl)amino)ethyl)pyrocatechol | ChEBI |
| levdobutamine | ChEMBL |
| LY-206243 | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 13 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15472663 | Reaxys |