EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H29N2O2.Cl |
| Net Charge | 0 |
| Average Mass | 461.005 |
| Monoisotopic Mass | 460.19176 |
| SMILES | N#CC(CC[NH+]1CCC(C(=O)O)(c2ccccc2)CC1)(c1ccccc1)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C28H28N2O2.ClH/c29-22-28(24-12-6-2-7-13-24,25-14-8-3-9-15-25)18-21-30-19-16-27(17-20-30,26(31)32)23-10-4-1-5-11-23;/h1-15H,16-21H2,(H,31,32);1H |
| InChIKey | VMIZTXDGZPTKIK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidiarrhoeal drug Any drug found useful in the symptomatic treatment of diarrhoea. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| difenoxin hydrochloride (CHEBI:59790) has part difenoxin (CHEBI:4534) |
| difenoxin hydrochloride (CHEBI:59790) has role antidiarrhoeal drug (CHEBI:55323) |
| difenoxin hydrochloride (CHEBI:59790) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 4-carboxy-1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidinium chloride |
| Synonyms | Source |
|---|---|
| difenoxin HCl | ChemIDplus |
| 1-(3-cyano-3,3-diphenylpropyl)-4-phenylpiperidine-4-carboxylic acid hydrochloride | IUPAC |
| diphenoxylic acid hydrochloride | ChemIDplus |
| 1-(3-cyano-3,3-diphenylpropyl)-4-phenylisonipecotic acid hydrochloride | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:35607-36-4 | ChemIDplus |