EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N.CH3O4S |
| Net Charge | 0 |
| Average Mass | 389.517 |
| Monoisotopic Mass | 389.16608 |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C)CCC(=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BREMLQBSKCSNNH-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphemanil methylsulfate (CHEBI:59782) has role bronchodilator agent (CHEBI:35523) |
| diphemanil methylsulfate (CHEBI:59782) has role muscarinic antagonist (CHEBI:48876) |
| diphemanil methylsulfate (CHEBI:59782) has role parasympatholytic (CHEBI:50370) |
| diphemanil methylsulfate (CHEBI:59782) is a piperidines (CHEBI:26151) |
| diphemanil methylsulfate (CHEBI:59782) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 4-(diphenylmethylidene)-1,1-dimethylpiperidinium methyl sulfate |
| INNs | Source |
|---|---|
| metilsulfate de diphemanil | ChemIDplus |
| metilsulfato de difemanilo | ChemIDplus |
| diphemanil methylsulfate | ChemIDplus |
| diphemanili metilsulfas | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate | ChemIDplus |
| p-(α-phenylbenzylidene)-1,1-dimethylpiperidinium methyl sulfate | ChemIDplus |
| diphemanil methosulfate | ChemIDplus |
| N,N-dimethyl-4-piperidylidene-1,1-diphenylmethane methylsulfate | ChEBI |
| diphemanil metilsulfate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D06878 | KEGG DRUG |
| DB00729 | DrugBank |
| US2739968 | Patent |
| Diphemanil | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3842254 | Beilstein |
| CAS:62-97-5 | KEGG DRUG |
| CAS:62-97-5 | ChemIDplus |