EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24N.CH3O4S |
| Net Charge | 0 |
| Average Mass | 389.517 |
| Monoisotopic Mass | 389.16608 |
| SMILES | COS(=O)(=O)[O-].C[N+]1(C)CCC(=C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H24N.CH4O4S/c1-21(2)15-13-19(14-16-21)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-5-6(2,3)4/h3-12H,13-16H2,1-2H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | BREMLQBSKCSNNH-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Applications: | parasympatholytic Any cholinergic antagonist that inhibits the actions of the parasympathetic nervous system. The major group of drugs used therapeutically for this purpose is the muscarinic antagonists. muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. bronchodilator agent An agent that causes an increase in the expansion of a bronchus or bronchial tubes. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphemanil methylsulfate (CHEBI:59782) has role bronchodilator agent (CHEBI:35523) |
| diphemanil methylsulfate (CHEBI:59782) has role muscarinic antagonist (CHEBI:48876) |
| diphemanil methylsulfate (CHEBI:59782) has role parasympatholytic (CHEBI:50370) |
| diphemanil methylsulfate (CHEBI:59782) is a diarylmethane (CHEBI:51614) |
| diphemanil methylsulfate (CHEBI:59782) is a organic molecular entity (CHEBI:50860) |
| diphemanil methylsulfate (CHEBI:59782) is a piperidines (CHEBI:26151) |
| diphemanil methylsulfate (CHEBI:59782) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| 4-(diphenylmethylidene)-1,1-dimethylpiperidinium methyl sulfate |
| INNs | Source |
|---|---|
| diphemanili metilsulfas | ChemIDplus |
| diphemanil methylsulfate | ChemIDplus |
| metilsulfate de diphemanil | ChemIDplus |
| metilsulfato de difemanilo | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-(diphenylmethylene)-1,1-dimethylpiperidinium methyl sulfate | ChemIDplus |
| diphemanil methosulfate | ChemIDplus |
| Diphemanil methylsulphate | ChEMBL |
| diphemanil metilsulfate | ChEBI |
| N,N-dimethyl-4-piperidylidene-1,1-diphenylmethane methylsulfate | ChEBI |
| p-(α-phenylbenzylidene)-1,1-dimethylpiperidinium methyl sulfate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Prantal | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| D06878 | KEGG DRUG |
| DB00729 | DrugBank |
| Diphemanil | Wikipedia |
| US2739968 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3842254 | Beilstein |
| CAS:62-97-5 | KEGG DRUG |
| CAS:62-97-5 | ChemIDplus |