EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NS2 |
| Net Charge | 0 |
| Average Mass | 263.431 |
| Monoisotopic Mass | 263.08024 |
| SMILES | CC(C=C(c1cccs1)c1cccs1)N(C)C |
| InChI | InChI=1S/C14H17NS2/c1-11(15(2)3)10-12(13-6-4-8-16-13)14-7-5-9-17-14/h4-11H,1-3H3 |
| InChIKey | CANBGVXYBPOLRR-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Application: | opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethylthiambutene (CHEBI:59781) has role opioid analgesic (CHEBI:35482) |
| dimethylthiambutene (CHEBI:59781) is a tertiary amine (CHEBI:32876) |
| dimethylthiambutene (CHEBI:59781) is a thiophenes (CHEBI:26961) |
| IUPAC Name |
|---|
| N,N-dimethyl-4,4-di(thiophen-2-yl)but-3-en-2-amine |
| INNs | Source |
|---|---|
| dimethylthiambutene | ChemIDplus |
| dimethylthiambutenum | ChemIDplus |
| dimetiltiambuteno | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-dimethylamino-1,1-bis(2-thienyl)-1-butene | ChemIDplus |
| 3-dimethylamino-1,1-di-(2'-thienyl)-1-butene | ChemIDplus |
| N,N,1-trimethyl-3,3-di(2-thienyl)-2-propenylamine | NIST Chemistry WebBook |
| N,N,1-trimethyl-3,3-di-2-thienylallylamine | ChemIDplus |
| N,N-dimethyl-4,4-di(2-thienyl)-3-buten-2-amine | NIST Chemistry WebBook |