EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N2O7P |
| Net Charge | -2 |
| Average Mass | 318.222 |
| Monoisotopic Mass | 318.06278 |
| SMILES | Cc1[nH+]cc(COP(=O)([O-])[O-])c(C[NH2+][C@@H](C)C(=O)[O-])c1[O-] |
| InChI | InChI=1S/C11H17N2O7P/c1-6-10(14)9(4-13-7(2)11(15)16)8(3-12-6)5-20-21(17,18)19/h3,7,13-14H,4-5H2,1-2H3,(H,15,16)(H2,17,18,19)/p-2/t7-/m0/s1 |
| InChIKey | WACJCHFWJNNBPR-ZETCQYMHSA-L |
| Roles Classification |
|---|
| Biological Roles: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) has role antigen (CHEBI:59132) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) has role epitope (CHEBI:53000) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) is a organophosphate oxoanion (CHEBI:58945) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) is conjugate base of N-(5'-phosphopyridoxyl)-L-alanine (CHEBI:44770) |
| Incoming Relation(s) |
| N-(5'-phosphopyridoxyl)-L-alanine (CHEBI:44770) is conjugate acid of N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) |
| IUPAC Name |
|---|
| (2S)-2-[({2-methyl-3-oxido-5-[(phosphonatooxy)methyl]pyridinium-4-yl}methyl)azaniumyl]propanoate |
| Synonyms | Source |
|---|---|
| PPL-L-alanine anion | ChEBI |
| PPL-L-alanine | ChEBI |
| N-(5'-phosphonatopyridoxyl)-L-alaninate dianion | ChEBI |
| PPL-L-alanine(1−) | ChEBI |
| Citations |
|---|