EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15N2O7P |
| Net Charge | -2 |
| Average Mass | 318.222 |
| Monoisotopic Mass | 318.06278 |
| SMILES | Cc1[nH+]cc(COP(=O)([O-])[O-])c(C[NH2+][C@@H](C)C(=O)[O-])c1[O-] |
| InChI | InChI=1S/C11H17N2O7P/c1-6-10(14)9(4-13-7(2)11(15)16)8(3-12-6)5-20-21(17,18)19/h3,7,13-14H,4-5H2,1-2H3,(H,15,16)(H2,17,18,19)/p-2/t7-/m0/s1 |
| InChIKey | WACJCHFWJNNBPR-ZETCQYMHSA-L |
| Roles Classification |
|---|
| Biological Roles: | epitope The biological role played by a material entity when bound by a receptor of the adaptive immune system. Specific site on an antigen to which an antibody binds. antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) has role antigen (CHEBI:59132) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) has role epitope (CHEBI:53000) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) is a organophosphate oxoanion (CHEBI:58945) |
| N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) is conjugate base of N-(5'-phosphopyridoxyl)-L-alanine (CHEBI:44770) |
| Incoming Relation(s) |
| N-(5'-phosphopyridoxyl)-L-alanine (CHEBI:44770) is conjugate acid of N-(5'-phosphonatopyridoxyl)-L-alaninate(2−) (CHEBI:59763) |
| IUPAC Name |
|---|
| (2S)-2-[({2-methyl-3-oxido-5-[(phosphonatooxy)methyl]pyridinium-4-yl}methyl)azaniumyl]propanoate |
| Synonyms | Source |
|---|---|
| N-(5'-phosphonatopyridoxyl)-L-alaninate dianion | ChEBI |
| PPL-L-alanine | ChEBI |
| PPL-L-alanine(1−) | ChEBI |
| PPL-L-alanine anion | ChEBI |
| Citations |
|---|