EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO2 |
| Net Charge | 0 |
| Average Mass | 165.192 |
| Monoisotopic Mass | 165.07898 |
| SMILES | CON(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C9H11NO2/c1-10(12-2)9(11)8-6-4-3-5-7-8/h3-7H,1-2H3 |
| InChIKey | UKERDACREYXSIV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | electrophilic reagent A reagent that forms a bond to its reaction partner (the nucleophile) by accepting both bonding electrons from that reaction partner. |
| Application: | electrophilic reagent A reagent that forms a bond to its reaction partner (the nucleophile) by accepting both bonding electrons from that reaction partner. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methoxy-N-methylbenzamide (CHEBI:59742) is a Weinreb amide (CHEBI:59741) |
| Synonyms | Source |
|---|---|
| N-methyl-N-methoxybenzamide | ChEBI |
| methyl N-methylbenzohydroxamate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1942902 | Beilstein |