EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O11 |
| Net Charge | 0 |
| Average Mass | 436.369 |
| Monoisotopic Mass | 436.10056 |
| SMILES | COc1c(O)ccc2c(=O)c3c(O)c([C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c(O)cc3oc12 |
| InChI | InChI=1S/C20H20O11/c1-29-19-7(22)3-2-6-13(24)12-9(30-18(6)19)4-8(23)11(15(12)26)20-17(28)16(27)14(25)10(5-21)31-20/h2-4,10,14,16-17,20-23,25-28H,5H2,1H3/t10-,14-,16+,17-,20+/m1/s1 |
| InChIKey | MTQVPZUZBBTLNO-HSLVGEKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Iris germanica (ncbitaxon:34205) | rhizome (BTO:0001181) | PubMed (25204177) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irisxanthone (CHEBI:5973) has role plant metabolite (CHEBI:76924) |
| irisxanthone (CHEBI:5973) is a C-glycosyl compound (CHEBI:20857) |
| irisxanthone (CHEBI:5973) is a aromatic ether (CHEBI:35618) |
| irisxanthone (CHEBI:5973) is a polyphenol (CHEBI:26195) |
| irisxanthone (CHEBI:5973) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| (1S)-1,5-anhydro-1-(1,3,6-trihydroxy-5-methoxy-9-oxo-9H-xanthen-2-yl)-D-glucitol |
| Citations |
|---|