EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10O6 |
| Net Charge | 0 |
| Average Mass | 298.250 |
| Monoisotopic Mass | 298.04774 |
| SMILES | O=c1c(-c2ccc(O)cc2)coc2cc3c(c(O)c12)OCO3 |
| InChI | InChI=1S/C16H10O6/c17-9-3-1-8(2-4-9)10-6-20-11-5-12-16(22-7-21-12)15(19)13(11)14(10)18/h1-6,17,19H,7H2 |
| InChIKey | NUGRQNBDTZWXTP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irilone (CHEBI:5970) has role antineoplastic agent (CHEBI:35610) |
| irilone (CHEBI:5970) has role immunomodulator (CHEBI:50846) |
| irilone (CHEBI:5970) has role metabolite (CHEBI:25212) |
| irilone (CHEBI:5970) is a hydroxyisoflavone (CHEBI:38755) |
| irilone (CHEBI:5970) is a organic heterotricyclic compound (CHEBI:26979) |
| irilone (CHEBI:5970) is a oxacycle (CHEBI:38104) |
| Incoming Relation(s) |
| irilone-4'-O-[β-D-glucopyranosyl-(1→6)-β-D-glucopyranoside] (CHEBI:66084) has functional parent irilone (CHEBI:5970) |
| IUPAC Name |
|---|
| 9-hydroxy-7-(4-hydroxyphenyl)-8H-[1,3]dioxolo[4,5-g]chromen-8-one |
| Synonyms | Source |
|---|---|
| 5,4'-dihydroxy-6,7-methylenedioxyisoflavone | ChEBI |
| 9-Hydroxy-7-(4-hydroxyphenyl)-8H-1,3-dioxolo[4,5-g]-1-benzopyran-8-one | ChEBI |
| Irilone | KEGG COMPOUND |
| Irolone | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00002539 | KNApSAcK |
| C10467 | KEGG COMPOUND |
| HMDB0033820 | HMDB |
| Irilone | Wikipedia |
| LMPK12050383 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1264266 | Reaxys |
| CAS:41653-81-0 | KEGG COMPOUND |
| Citations |
|---|