EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]12CCCC(C)(C)C1=CC[C@H](C)[C@@]2(C)CCC(C)(O)C=C |
| InChI | InChI=1S/C20H34O/c1-7-19(5,21)13-14-20(6)15(2)10-11-16-17(20)9-8-12-18(16,3)4/h7,11,15,17,21H,1,8-10,12-14H2,2-6H3/t15-,17+,19?,20+/m0/s1 |
| InChIKey | TXBORCBWDUAHAC-AIQOQHTRSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edaxadiene (CHEBI:59685) has role metabolite (CHEBI:25212) |
| edaxadiene (CHEBI:59685) is a carbobicyclic compound (CHEBI:36785) |
| edaxadiene (CHEBI:59685) is a halimane diterpenoid (CHEBI:59686) |
| edaxadiene (CHEBI:59685) is a tertiary alcohol (CHEBI:26878) |
| Incoming Relation(s) |
| (13R)-edaxadiene (CHEBI:63178) is a edaxadiene (CHEBI:59685) |
| (13S)-edaxadiene (CHEBI:63180) is a edaxadiene (CHEBI:59685) |
| IUPAC Name |
|---|
| 3-methyl-5-[(1R,2S,8aS)-1,2,5,5-tetramethyl-1,2,3,5,6,7,8,8a-octahydronaphthalen-1-yl]pent-1-en-3-ol |
| Synonyms | Source |
|---|---|
| isotuberculosinol | ChEBI |
| nosyberkol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20769504 | Reaxys |
| Citations |
|---|