EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H31AsN2O15S |
| Net Charge | 0 |
| Average Mass | 610.423 |
| Monoisotopic Mass | 610.06611 |
| SMILES | CC(=O)N[C@@H](CS[As](=O)(O)O)C(=O)N[C@H]1[C@@H](O[C@@H]2[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H31AsN2O15S/c1-4(22)19-5(3-36-18(31,32)33)16(30)20-7-9(24)8(23)6(2-21)34-17(7)35-15-13(28)11(26)10(25)12(27)14(15)29/h5-15,17,21,23-29H,2-3H2,1H3,(H,19,22)(H,20,30)(H2,31,32,33)/t5-,6+,7+,8+,9+,10-,11-,12+,13+,14+,15-,17+/m0/s1 |
| InChIKey | UFFVRAZTLALLGR-FQBKTPCVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arseno-mycothiol (CHEBI:59651) is a arsenic molecular entity (CHEBI:22632) |
| arseno-mycothiol (CHEBI:59651) is conjugate acid of arseno-mycothiol(1−) (CHEBI:59653) |
| Incoming Relation(s) |
| arseno-mycothiol(1−) (CHEBI:59653) is conjugate base of arseno-mycothiol (CHEBI:59651) |
| IUPAC Name |
|---|
| (1S,2R,3R,4S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexyl 2-[(N-acetyl-S-arsono-L-cysteinyl)amino]-2-deoxy-α-D-glucopyranoside |
| Synonym | Source |
|---|---|
| arsenomycothiol | ChEBI |
| Citations |
|---|