EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35NO.HCl |
| Net Charge | 0 |
| Average Mass | 353.978 |
| Monoisotopic Mass | 353.24854 |
| SMILES | CCC(C)(C)c1ccc(CC(C)CN2C[C@@H](C)O[C@@H](C)C2)cc1.Cl |
| InChI | InChI=1S/C21H35NO.ClH/c1-7-21(5,6)20-10-8-19(9-11-20)12-16(2)13-22-14-17(3)23-18(4)15-22;/h8-11,16-18H,7,12-15H2,1-6H3;1H/t16?,17-,18+; |
| InChIKey | XZKWIPVTHGWDCF-KUZYQSSXSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.70 (Delta(14)-sterol reductase) inhibitor An EC 1.3.1.* (oxidoreductase acting on donor CH-CH group, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of Δ14-sterol reductase (EC 1.3.1.70). EC 5.3.3.5 (cholestenol Delta-isomerase) inhibitor An EC 5.3.3.* (intramolecular oxidase transposing C=C bonds) inhibitor that interferes with the action of a cholestenol Δ-isomerase (EC 5.3.3.5). EC 1.14.13.132 (squalene monooxygenase) inhibitor An EC 1.14.13.* (oxidoreductase acting on paired donors, incorporating 1 atom of oxygen, with NADH or NADPH as one donor) inhibitor that interferes with the action of squalene monooxygenase (EC 1.14.13.132). antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| amorolfine hydrochloride (CHEBI:59649) has part amorolfine(1+) (CHEBI:86380) |
| amorolfine hydrochloride (CHEBI:59649) has role EC 1.14.13.132 (squalene monooxygenase) inhibitor (CHEBI:59285) |
| amorolfine hydrochloride (CHEBI:59649) has role EC 1.3.1.70 (Δ14-sterol reductase) inhibitor (CHEBI:83319) |
| amorolfine hydrochloride (CHEBI:59649) has role EC 5.3.3.5 (cholestenol Δ-isomerase) inhibitor (CHEBI:86385) |
| amorolfine hydrochloride (CHEBI:59649) is a hydrochloride (CHEBI:36807) |
| amorolfine hydrochloride (CHEBI:59649) is a morpholine antifungal drug (CHEBI:87135) |
| IUPAC Name |
|---|
| (2R,6S)-2,6-dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine hydrochloride |
| Synonym | Source |
|---|---|
| meso-2,6-dimethyl-4-{2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propyl}morpholine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D01720 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9364702 | Beilstein |
| CAS:78613-38-4 | KEGG DRUG |
| CAS:78613-38-4 | ChemIDplus |