EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20O2 |
| Net Charge | 0 |
| Average Mass | 184.279 |
| Monoisotopic Mass | 184.14633 |
| SMILES | C=C(C)[C@@H]1CCC(C)C(C)(OO)C1 |
| InChI | InChI=1S/C11H20O2/c1-8(2)10-6-5-9(3)11(4,7-10)13-12/h9-10,12H,1,5-7H2,2-4H3/t9?,10-,11?/m1/s1 |
| InChIKey | PAWAQGFGYJWLSH-HSOILSAZSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R)-5-isopropenyl-1,2-dimethylcyclohexane 1-hydroperoxide (CHEBI:59624) has functional parent (−)-carvone (CHEBI:15400) |
| (5R)-5-isopropenyl-1,2-dimethylcyclohexane 1-hydroperoxide (CHEBI:59624) has role allergen (CHEBI:50904) |
| (5R)-5-isopropenyl-1,2-dimethylcyclohexane 1-hydroperoxide (CHEBI:59624) has role hapten (CHEBI:59174) |
| (5R)-5-isopropenyl-1,2-dimethylcyclohexane 1-hydroperoxide (CHEBI:59624) is a peroxol (CHEBI:35924) |
| IUPAC Name |
|---|
| (5R)-1,2-dimethyl-5-(prop-1-en-2-yl)cyclohexane-1-peroxol |
| Synonyms | Source |
|---|---|
| (5R)-1,2-dimethyl-5-(prop-1-en-2-yl)cyclohexyl hydroperoxide | IUPAC |
| (5R)-5-isopropenyl-1,2-dimethylcyclohexane-1-hydroperoxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21053500 | Reaxys |
| Citations |
|---|