EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H18O2 |
| Net Charge | 0 |
| Average Mass | 170.252 |
| Monoisotopic Mass | 170.13068 |
| SMILES | C=C(C)[C@@H]1CCC(C)C(OO)C1 |
| InChI | InChI=1S/C10H18O2/c1-7(2)9-5-4-8(3)10(6-9)12-11/h8-11H,1,4-6H2,2-3H3/t8?,9-,10?/m1/s1 |
| InChIKey | LCPSGOHUUMKVEZ-HWOCKDDLSA-N |
| Roles Classification |
|---|
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5R)-5-isopropenyl-2-methylcyclohexane 1-hydroperoxide (CHEBI:59623) has parent hydride (4R)-limonene (CHEBI:15382) |
| (5R)-5-isopropenyl-2-methylcyclohexane 1-hydroperoxide (CHEBI:59623) has role allergen (CHEBI:50904) |
| (5R)-5-isopropenyl-2-methylcyclohexane 1-hydroperoxide (CHEBI:59623) has role hapten (CHEBI:59174) |
| (5R)-5-isopropenyl-2-methylcyclohexane 1-hydroperoxide (CHEBI:59623) is a peroxol (CHEBI:35924) |
| IUPAC Name |
|---|
| (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexane-1-peroxol |
| Synonyms | Source |
|---|---|
| (5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexyl hydroperoxide | IUPAC |
| (5R)-5-isopropenyl-2-methylcyclohexane-1-hydroperoxide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21053497 | Reaxys |
| Citations |
|---|