EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19N5S |
| Net Charge | 0 |
| Average Mass | 253.375 |
| Monoisotopic Mass | 253.13612 |
| SMILES | CSc1nc(NC2CC2)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C11H19N5S/c1-11(2,3)16-9-13-8(12-7-5-6-7)14-10(15-9)17-4/h7H,5-6H2,1-4H3,(H2,12,13,14,15,16) |
| InChIKey | HDHLIWCXDDZUFH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | antifouling biocide A compound that inhibits the growth of marine organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irgarol 1051 (CHEBI:5962) has functional parent 1,3,5-triazine-2,4-diamine (CHEBI:38071) |
| irgarol 1051 (CHEBI:5962) has parent hydride 1,3,5-triazine (CHEBI:30259) |
| irgarol 1051 (CHEBI:5962) has role antifouling biocide (CHEBI:51076) |
| irgarol 1051 (CHEBI:5962) has role environmental contaminant (CHEBI:78298) |
| irgarol 1051 (CHEBI:5962) has role xenobiotic (CHEBI:35703) |
| irgarol 1051 (CHEBI:5962) is a aryl sulfide (CHEBI:35683) |
| irgarol 1051 (CHEBI:5962) is a cyclopropanes (CHEBI:51454) |
| irgarol 1051 (CHEBI:5962) is a diamino-1,3,5-triazine (CHEBI:38170) |
| IUPAC Name |
|---|
| N-tert-butyl-N'-cyclopropyl-6-(methylsulfanyl)-1,3,5-triazine-2,4-diamine |
| Synonym | Source |
|---|---|
| Cybutryne | ChemIDplus |
| Brand Name | Source |
|---|---|
| Irgarol 1051 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:792218 | Reaxys |
| CAS:28159-98-0 | ChemIDplus |
| Citations |
|---|