EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Cl6Pt.2Na |
| Net Charge | 0 |
| Average Mass | 453.776 |
| Monoisotopic Mass | 450.75745 |
| SMILES | [Cl][Pt-2]([Cl])([Cl])([Cl])([Cl])[Cl].[Na+].[Na+] |
| InChI | InChI=1S/6ClH.2Na.Pt/h6*1H;;;/q;;;;;;2*+1;+4/p-6 |
| InChIKey | QGFSULIVEYGQQY-UHFFFAOYSA-H |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| Application: | NMR chemical shift reference compound Any compound that produces a peak used as reference frequency in the δ chemical shift scale. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium hexachloroplatinate (CHEBI:59606) has part hexachloroplatinate(2−) (CHEBI:30119) |
| sodium hexachloroplatinate (CHEBI:59606) has role NMR chemical shift reference compound (CHEBI:228364) |
| sodium hexachloroplatinate (CHEBI:59606) is a inorganic sodium salt (CHEBI:38702) |
| IUPAC Names |
|---|
| sodium hexachloridoplatinate(2−) |
| sodium hexachloridoplatinate(IV) |
| Synonym | Source |
|---|---|
| Disodium hexachloroplatinate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Sodium_hexachloroplatinate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322243 | Reaxys |
| CAS:16923-58-3 | ChemIDplus |
| Citations |
|---|