EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N5O4S |
| Net Charge | 0 |
| Average Mass | 377.426 |
| Monoisotopic Mass | 377.11578 |
| SMILES | CCN(CCOC(C)=O)c1ccc(N=Nc2ncc([N+](=O)[O-])s2)c(C)c1 |
| InChI | InChI=1S/C16H19N5O4S/c1-4-20(7-8-25-12(3)22)13-5-6-14(11(2)9-13)18-19-16-17-10-15(26-16)21(23)24/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | HMAJVAFLGGPIPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disperse Blue 124 (CHEBI:59605) has role allergen (CHEBI:50904) |
| Disperse Blue 124 (CHEBI:59605) has role dye (CHEBI:37958) |
| Disperse Blue 124 (CHEBI:59605) has role hapten (CHEBI:59174) |
| Disperse Blue 124 (CHEBI:59605) is a 1,3-thiazoles (CHEBI:38418) |
| Disperse Blue 124 (CHEBI:59605) is a monoazo compound (CHEBI:48959) |
| Disperse Blue 124 (CHEBI:59605) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 2-(ethyl{3-methyl-4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]phenyl}amino)ethyl acetate |
| Synonyms | Source |
|---|---|
| 2-(N-ethyl-4-((5-nitrothiazol-2-yl)azo)-m-toluidino)ethyl acetate | ChEBI |
| C.I. Disperse Blue 124 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:15141-18-1 | ChemIDplus |
| CAS:61951-51-7 | ChemIDplus |
| Citations |
|---|