EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19N5O4S |
| Net Charge | 0 |
| Average Mass | 377.426 |
| Monoisotopic Mass | 377.11578 |
| SMILES | CCN(CCOC(C)=O)c1ccc(N=Nc2ncc([N+](=O)[O-])s2)c(C)c1 |
| InChI | InChI=1S/C16H19N5O4S/c1-4-20(7-8-25-12(3)22)13-5-6-14(11(2)9-13)18-19-16-17-10-15(26-16)21(23)24/h5-6,9-10H,4,7-8H2,1-3H3 |
| InChIKey | HMAJVAFLGGPIPN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | hapten Any substance capable of eliciting an immune response only when attached to a large carrier such as a protein. Examples include dinitrophenols; oligosaccharides; peptides; and heavy metals. allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disperse Blue 124 (CHEBI:59605) has role allergen (CHEBI:50904) |
| Disperse Blue 124 (CHEBI:59605) has role dye (CHEBI:37958) |
| Disperse Blue 124 (CHEBI:59605) has role hapten (CHEBI:59174) |
| Disperse Blue 124 (CHEBI:59605) is a 1,3-thiazoles (CHEBI:38418) |
| Disperse Blue 124 (CHEBI:59605) is a monoazo compound (CHEBI:48959) |
| Disperse Blue 124 (CHEBI:59605) is a tertiary amine (CHEBI:32876) |
| IUPAC Name |
|---|
| 2-(ethyl{3-methyl-4-[(5-nitro-1,3-thiazol-2-yl)diazenyl]phenyl}amino)ethyl acetate |
| Synonyms | Source |
|---|---|
| 2-(N-ethyl-4-((5-nitrothiazol-2-yl)azo)-m-toluidino)ethyl acetate | ChEBI |
| C.I. Disperse Blue 124 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:15141-18-1 | ChemIDplus |
| CAS:61951-51-7 | ChemIDplus |
| Citations |
|---|