EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N2O7S2 |
| Net Charge | +1 |
| Average Mass | 561.702 |
| Monoisotopic Mass | 561.17237 |
| SMILES | CCN(CC)c1ccc(C(=C2C=CC(=[N+](CC)CC)C=C2)c2cc(O)c(S(=O)(=O)O)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C27H32N2O7S2/c1-5-28(6-2)21-13-9-19(10-14-21)27(20-11-15-22(16-12-20)29(7-3)8-4)23-17-24(30)26(38(34,35)36)18-25(23)37(31,32)33/h9-18H,5-8H2,1-4H3,(H2-,30,31,32,33,34,35,36)/p+1 |
| InChIKey | DHAHKSQXIXFZJB-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Biological Role: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Application: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| patent blue V (CHEBI:59601) has role allergen (CHEBI:50904) |
| patent blue V (CHEBI:59601) has role dye (CHEBI:37958) |
| patent blue V (CHEBI:59601) is a iminium ion (CHEBI:35286) |
| IUPAC Name |
|---|
| N-(4-{[4-(diethylamino)phenyl](5-hydroxy-2,4-disulfophenyl)methylene}cyclohexa-2,5-dien-1-ylidene)-N-ethylethanaminium |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15587856 | Reaxys |
| Citations |
|---|