EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28N6O |
| Net Charge | 0 |
| Average Mass | 428.540 |
| Monoisotopic Mass | 428.23246 |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2-c2nnnn2)cc1 |
| InChI | InChI=1S/C25H28N6O/c1-2-3-10-22-26-25(15-6-7-16-25)24(32)31(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)23-27-29-30-28-23/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,28,29,30) |
| InChIKey | YOSHYTLCDANDAN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Applications: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irbesartan (CHEBI:5959) has role angiotensin receptor antagonist (CHEBI:61016) |
| irbesartan (CHEBI:5959) has role antihypertensive agent (CHEBI:35674) |
| irbesartan (CHEBI:5959) has role environmental contaminant (CHEBI:78298) |
| irbesartan (CHEBI:5959) has role xenobiotic (CHEBI:35703) |
| irbesartan (CHEBI:5959) is a azaspiro compound (CHEBI:35624) |
| irbesartan (CHEBI:5959) is a biphenylyltetrazole (CHEBI:48420) |
| IUPAC Name |
|---|
| 2-butyl-3-{[2'-(1H-tetrazol-5-yl)[1,1'-biphenyl]-4-yl]methyl}-1,3-diazaspiro[4.4]non-1-en-4-one |
| INN | Source |
|---|---|
| irbesartan | ChemIDplus |
| Synonyms | Source |
|---|---|
| Irbesartan | KEGG COMPOUND |
| 2-butyl-3-{[2'-(1H-tetrazol-5-yl)biphenyl-4-yl]methyl}-1,3-diazaspiro[4.4]non-1-en-4-one | IUPAC |
| BMS 186295 | ChemIDplus |
| Brand Name | Source |
|---|---|
| Avapro | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6620400 | Reaxys |
| CAS:138402-11-6 | KEGG COMPOUND |
| CAS:138402-11-6 | ChemIDplus |
| Citations |
|---|