EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH2Cl2O6P2.2Na |
| Net Charge | 0 |
| Average Mass | 288.855 |
| Monoisotopic Mass | 287.84990 |
| SMILES | O=P([O-])(O)C(Cl)(Cl)P(=O)([O-])O.[Na+].[Na+] |
| InChI | InChI=1S/CH4Cl2O6P2.2Na/c2-1(3,10(4,5)6)11(7,8)9;;/h(H2,4,5,6)(H2,7,8,9);;/q;2*+1/p-2 |
| InChIKey | HJKBJIYDJLVSAO-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clodronic acid disodium salt (CHEBI:59586) has part clondronate(2−) (CHEBI:59585) |
| clodronic acid disodium salt (CHEBI:59586) has role bone density conservation agent (CHEBI:50646) |
| clodronic acid disodium salt (CHEBI:59586) is a one-carbon compound (CHEBI:64708) |
| clodronic acid disodium salt (CHEBI:59586) is a organic sodium salt (CHEBI:38700) |
| Incoming Relation(s) |
| disodium clodronate tetrahydrate (CHEBI:59587) has part clodronic acid disodium salt (CHEBI:59586) |
| IUPAC Name |
|---|
| disodium (dichloromethanediyl)bis[hydrogen (phosphonate)] |
| Synonyms | Source |
|---|---|
| clodronate disodium | KEGG DRUG |
| clodronate sodium | ChemIDplus |
| clodronic acid disodium salt | KEGG DRUG |
| disodium clodronate | ChemIDplus |
| disodium (dichloromethylene)bisphosphonate | ChemIDplus |
| disodium (dichloromethylene)diphosphonate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D07720 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5841154 | Beilstein |
| CAS:22560-50-5 | KEGG DRUG |
| CAS:22560-50-5 | ChemIDplus |