EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13N3O |
| Net Charge | 0 |
| Average Mass | 179.223 |
| Monoisotopic Mass | 179.10586 |
| SMILES | CC(C)NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C9H13N3O/c1-7(2)11-12-9(13)8-3-5-10-6-4-8/h3-7,11H,1-2H3,(H,12,13) |
| InChIKey | NYMGNSNKLVNMIA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iproniazid (CHEBI:5958) has role antidepressant (CHEBI:35469) |
| Iproniazid (CHEBI:5958) is a carbohydrazide (CHEBI:35363) |
| Iproniazid (CHEBI:5958) is a organic molecular entity (CHEBI:50860) |
| Iproniazid (CHEBI:5958) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| iproniazida | WHO MedNet |
| Synonyms | Source |
|---|---|
| euphozid | DrugCentral |
| iprazid | DrugCentral |
| iprazide | DrugCentral |
| Iproniazid | KEGG COMPOUND |
| iproniazide | DrugCentral |
| iproniazide phosphate | DrugCentral |
| Citations |
|---|