EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O6 |
| Net Charge | 0 |
| Average Mass | 180.156 |
| Monoisotopic Mass | 180.06339 |
| SMILES | OC[C@@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a2121h-1a_1-5]/1/ |
| InChI | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6+/m0/s1 |
| InChIKey | WQZGKKKJIJFFOK-DSOBHZJASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-L-idopyranose (CHEBI:59552) is a L-idopyranose (CHEBI:86061) |
| Incoming Relation(s) |
| L-idopyranose 6-monomycolate (CHEBI:42782) has functional parent α-L-idopyranose (CHEBI:59552) |
| Synonyms | Source |
|---|---|
| α-L-idopyranose | ChEBI |
| α-L-idose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| G24050VV | GlyTouCan |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1907367 | Reaxys |
| Citations |
|---|