EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N3O12P |
| Net Charge | -2 |
| Average Mass | 513.352 |
| Monoisotopic Mass | 513.07956 |
| SMILES | C[C@H](OP(=O)([O-])OC[C@@H](O)[C@@H](O)[C@@H](O)Cn1c2nc(=O)nc(=O)c-2cc2ccc(O)cc21)C(=O)[O-] |
| InChI | InChI=1S/C19H22N3O12P/c1-8(18(28)29)34-35(31,32)33-7-14(25)15(26)13(24)6-22-12-5-10(23)3-2-9(12)4-11-16(22)20-19(30)21-17(11)27/h2-5,8,13-15,23-26H,6-7H2,1H3,(H,28,29)(H,31,32)(H,21,27,30)/p-2/t8-,13-,14+,15-/m0/s1 |
| InChIKey | QNHKLTYSDLGJSR-GQPBWUKJSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| F420-0(2−) (CHEBI:59531) has functional parent 2-phospho-L-lactic acid (CHEBI:45013) |
| F420-0(2−) (CHEBI:59531) is a dialkyl phosphate anion (CHEBI:58944) |
| F420-0(2−) (CHEBI:59531) is a monocarboxylic acid anion (CHEBI:35757) |
| F420-0(2−) (CHEBI:59531) is a pyrimidoquinolines (CHEBI:59535) |
| F420-0(2−) (CHEBI:59531) is a ribitol phosphate (CHEBI:26554) |
| F420-0(2−) (CHEBI:59531) is conjugate base of F420-0 (CHEBI:59532) |
| Incoming Relation(s) |
| F420-0 (CHEBI:59532) is conjugate acid of F420-0(2−) (CHEBI:59531) |
| IUPAC Name |
|---|
| 5-O-{[(1S)-1-carboxylatoethoxy]phosphinato}-1-deoxy-1-(8-hydroxy-2,4-dioxo-3,4-dihydropyrimido[4,5-b]quinolin-10(2H)-yl)-D-ribitol |
| Synonyms | Source |
|---|---|
| coenzyme F420-0(2−) | ChEBI |
| coenzyme F420-0 dianion | ChEBI |
| F420-0 | ChEBI |
| F420-0 dianion | ChEBI |
| Citations |
|---|