EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H25N2O5S.Na |
| Net Charge | 0 |
| Average Mass | 380.442 |
| Monoisotopic Mass | 380.13819 |
| SMILES | CC1(C)C[C@@H]1C(=O)N/C(=C\CCCCSC[C@H](N)C(=O)[O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C16H26N2O5S.Na/c1-16(2)8-10(16)13(19)18-12(15(22)23)6-4-3-5-7-24-9-11(17)14(20)21;/h6,10-11H,3-5,7-9,17H2,1-2H3,(H,18,19)(H,20,21)(H,22,23);/q;+1/p-1/b12-6-;/t10-,11+;/m1./s1 |
| InChIKey | QXPBTTUOVWMPJN-QBNHLFMHSA-M |
| Roles Classification |
|---|
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). EC 3.4.13.19 (membrane dipeptidase) inhibitor An EC 3.4.13.* (dipeptidase) inhibitor that interferes with the action of membrane dipeptidase (EC 3.4.13.19). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cilastatin sodium (CHEBI:59511) has part cilastatin(1−) (CHEBI:59512) |
| cilastatin sodium (CHEBI:59511) has role EC 3.4.13.19 (membrane dipeptidase) inhibitor (CHEBI:76926) |
| cilastatin sodium (CHEBI:59511) has role protease inhibitor (CHEBI:37670) |
| cilastatin sodium (CHEBI:59511) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (2R)-2-amino-3-{[(5Z)-6-carboxy-6-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)hex-5-en-1-yl]sulfanyl}propanoate |
| Synonyms | Source |
|---|---|
| (Z)-(S)-6-carboxy-6-[(S)-2,2-dimethylcyclopropanecarboxamido]hex-5-enyl-L-cysteine monosodium salt | ChEBI |
| sodium (2Z)-7-{[(2R)-2-amino-2-carboxyethyl]sulfanyl}-2-({[(1S)-2,2-dimethylcyclopropyl]carbonyl}amino)hept-2-enoate | IUPAC |
| sodium (Z)-7-(((R)-2-amino-2-carboxyethyl)thio)-2-((S)-2,2-dimethylcyclopropanecarboxamido)-2-heptenoate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8179743 | Beilstein |
| CAS:81129-83-1 | ChemIDplus |