EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12I3NO2 |
| Net Charge | 0 |
| Average Mass | 570.934 |
| Monoisotopic Mass | 570.80022 |
| SMILES | CCC(Cc1c(I)cc(I)c(N)c1I)C(=O)O |
| InChI | InChI=1S/C11H12I3NO2/c1-2-5(11(16)17)3-6-7(12)4-8(13)10(15)9(6)14/h4-5H,2-3,15H2,1H3,(H,16,17) |
| InChIKey | OIRFJRBSRORBCM-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iopanoic acid (CHEBI:5951) is a monocarboxylic acid (CHEBI:25384) |
| Synonyms | Source |
|---|---|
| iodopanic acid | DrugCentral |
| iodopanoic acid | DrugCentral |
| Iopanoic acid | KEGG COMPOUND |
| iopanoicum | DrugCentral |