EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:5950 - iodoquinol
| Formula | C9H5I2NO |
| Net Charge | 0 |
| Average Mass | 396.953 |
| Monoisotopic Mass | 396.84606 |
| SMILES | Oc1c(I)cc(I)c2cccnc12 |
| InChI | InChI=1S/C9H5I2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | UXZFQZANDVDGMM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| Applications: | antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodoquinol (CHEBI:5950) has role antiamoebic agent (CHEBI:171664) |
| iodoquinol (CHEBI:5950) has role antibacterial agent (CHEBI:33282) |
| iodoquinol (CHEBI:5950) has role antiprotozoal drug (CHEBI:35820) |
| iodoquinol (CHEBI:5950) has role antiseptic drug (CHEBI:48218) |
| iodoquinol (CHEBI:5950) is a monohydroxyquinoline (CHEBI:38775) |
| iodoquinol (CHEBI:5950) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5,7-diiodoquinolin-8-ol |
| INNs | Source |
|---|---|
| diiodohidroxiquinoleína | WHO MedNet |
| diiodohydroxyquinoléine | WHO MedNet |
| diiodohydroxyquinoline | WHO MedNet |
| diiodohydroxyquinolinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5,7-diiodo-8-hydroxyquinoline | ChemIDplus |
| 5,7-diiodo-8-quinolinol | ChemIDplus |
| 8-hydroxy-5,7-diiodoquinoline | ChemIDplus |
| diiodohydroxyquin | DrugCentral |
| di-iodohydroxyquinoline | WHO MedNet |
| diiodoquin | DrugCentral |
| Brand Names | Source |
|---|---|
| Diamoebin | ChemIDplus |
| Diodoquine | ChemIDplus |
| Diodoxylin | ChemIDplus |
| Diquinol | ChEBI |
| Direxiode | ChemIDplus |
| Dyodin | ChemIDplus |
| Citations |
|---|