EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H5I2NO |
| Net Charge | 0 |
| Average Mass | 396.953 |
| Monoisotopic Mass | 396.84606 |
| SMILES | Oc1c(I)cc(I)c2cccnc12 |
| InChI | InChI=1S/C9H5I2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey | UXZFQZANDVDGMM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antiseptic drug A substance used locally on humans and other animals to destroy harmful microorganisms or to inhibit their activity (cf. disinfectants, which destroy microorganisms found on non-living objects, and antibiotics, which can be transported through the lymphatic system to destroy bacteria within the body). antiamoebic agent An antiparasitic agent which is effective against amoeba, a genus of single-celled amoeboids in the family Amoebidae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodoquinol (CHEBI:5950) has role antiamoebic agent (CHEBI:171664) |
| iodoquinol (CHEBI:5950) has role antibacterial agent (CHEBI:33282) |
| iodoquinol (CHEBI:5950) has role antiprotozoal drug (CHEBI:35820) |
| iodoquinol (CHEBI:5950) has role antiseptic drug (CHEBI:48218) |
| iodoquinol (CHEBI:5950) is a monohydroxyquinoline (CHEBI:38775) |
| iodoquinol (CHEBI:5950) is a organoiodine compound (CHEBI:37142) |
| IUPAC Name |
|---|
| 5,7-diiodoquinolin-8-ol |
| INNs | Source |
|---|---|
| diiodohidroxiquinoleína | WHO MedNet |
| diiodohydroxyquinoléine | WHO MedNet |
| diiodohydroxyquinoline | WHO MedNet |
| diiodohydroxyquinolinum | WHO MedNet |
| Synonyms | Source |
|---|---|
| 5,7-diiodo-8-hydroxyquinoline | ChemIDplus |
| 5,7-diiodo-8-quinolinol | ChemIDplus |
| 8-hydroxy-5,7-diiodoquinoline | ChemIDplus |
| diiodohydroxyquin | DrugCentral |
| di-iodohydroxyquinoline | WHO MedNet |
| diiodoquin | DrugCentral |
| Brand Names | Source |
|---|---|
| Diamoebin | ChemIDplus |
| Diodoquine | ChemIDplus |
| Diodoxylin | ChemIDplus |
| Diquinol | ChEBI |
| Direxiode | ChemIDplus |
| Dyodin | ChemIDplus |
| Citations |
|---|