EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H14N3O6P.2H2O |
| Net Charge | 0 |
| Average Mass | 315.219 |
| Monoisotopic Mass | 315.08315 |
| SMILES | Nc1ccn(C[C@@H](CO)OCP(=O)(O)O)c(=O)n1.O.O |
| InChI | InChI=1S/C8H14N3O6P.2H2O/c9-7-1-2-11(8(13)10-7)3-6(4-12)17-5-18(14,15)16;;/h1-2,6,12H,3-5H2,(H2,9,10,13)(H2,14,15,16);2*1H2/t6-;;/m0../s1 |
| InChIKey | FPKARFMSZDBYQF-ILKKLZGPSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cidofovir dihydrate (CHEBI:59495) has part cidofovir anhydrous (CHEBI:3696) |
| cidofovir dihydrate (CHEBI:59495) has role antineoplastic agent (CHEBI:35610) |
| cidofovir dihydrate (CHEBI:59495) has role antiviral drug (CHEBI:36044) |
| cidofovir dihydrate (CHEBI:59495) is a hydrate (CHEBI:35505) |
| IUPAC Name |
|---|
| ({[(2S)-1-(4-amino-2-oxopyrimidin-1(2H)-yl)-3-hydroxypropan-2-yl]oxy}methyl)phosphonic acid—water (1/2) |
| INN | Source |
|---|---|
| cidofovir | ChemIDplus |
| Synonyms | Source |
|---|---|
| 1-((S)-3-hydroxy-2-(phosphonomethoxy)propyl)cytosine dihydrate | ChemIDplus |
| ({[(2S)-1-(4-amino-2-oxopyrimidin-1(2H)-yl)-3-hydroxypropan-2-yl]oxy}methyl)phosphonic acid dihydrate | IUPAC |
| cidofovir hydrate | ChemIDplus |
| (((S)-2-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1-(hydroxymethyl)ethoxy)methyl)phosphonic acid, dihydrate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:149394-66-1 | ChemIDplus |